What is the formula of 3 methyl butane?
What is the formula of 3 methyl butane?
3-Methylbutane-1,2-diol | C5H12O2 – PubChem.
What is the common name of 3 methyl 4 Heptanone?
3-Methyl-4-heptanone 95.0+%, TCI America
| CAS | 15726-15-5 |
|---|---|
| InChI Key | NHIMSNHOEAVUKE-UHFFFAOYNA-N |
| Synonym | sec-Butyl Propyl Ketone |
| PubChem CID | 27470 |
| IUPAC Name | 3-methylheptan-4-one |
Which of the following is 1 chloro 3 Methylbutane?
1-Chloro-3-methylbutane
| PubChem CID | 7893 |
|---|---|
| Molecular Formula | C5H11Cl |
| Synonyms | 1-CHLORO-3-METHYLBUTANE Isoamyl chloride 107-84-6 Butane, 1-chloro-3-methyl- 3-Methylbutyl chloride More… |
| Molecular Weight | 106.59 |
| Dates | Modify 2021-12-05 Create 2005-03-26 |
What is the common name of 1 chloro 3 methyl butane?
1-Chloro-3-methylbutane 98.0+%, TCI America
| CAS | 107-84-6 |
|---|---|
| Synonym | isoamyl chloride, butane, 1-chloro-3-methyl, 3-methylbutyl chloride, isopentyl chloride, 4-chloro-2-methylbutane, 1-chloro-3,3-dimethylpropane, unii-87d3zl9f7a, isoamylchlorid, acmc-2098xt, 1-chloro-3-methyl-butane |
| PubChem CID | 7893 |
How many bonds are there in 3 Methylbutane?
Chemical Structure Description The 1-Iodo-3-methylbutane molecule contains a total of 16 bond(s) There are 5 non-H bond(s) and 1 rotatable bond(s).
What is the major product of the reaction of HBr with 3 methyl 1 butene?
When 3-methyl-1-butene reacts with HBr, two alkyl halides are formed, 2-bromo-3-methyl butane and 2-bromo-2-methyl butane.
What is the structure of 2 chloro 3 methyl pentane?
C6H13Cl
2-Chloro-3-methylpentane | C6H13Cl – PubChem.
What is the common name of 1 chloro 2 methyl butane?
1-Chloro-2-methylbutane
| PubChem CID | 12015 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C5H11Cl |
| Synonyms | 1-Chloro-2-methylbutane 616-13-7 Butane, 1-chloro-2-methyl- Butane, 1-chloro-2-methyl-, (S)- EINECS 210-466-9 More… |
What is the structure of 2 chloro 4 Methylpentane?
Compound with free spectra: 1 NMR
| SpectraBase Compound ID | 4RAb62p1sAl |
|---|---|
| InChI | InChI=1S/C6H13Cl/c1-5(2)4-6(3)7/h5-6H,4H2,1-3H3 |
| InChIKey | WIMBRKMSNRCNMP-UHFFFAOYSA-N |
| Mol Weight | 120.62 g/mol |
| Molecular Formula | C6H13Cl |
Is 3-Methyl-2-butanone a methyl ketone?
3-Methyl-2-butanone (methyl isopropyl ketone, MIPK) is a ketone and solvent of minor importance.
Why is 2 Ethylpentane not among the isomers of heptane?
The image shows a new chain which is actually 6 carbons long (hexane), and there’s now a methyl group on the third carbon (3-methyl). Together, this is 3-methylhexane. Because of this, ‘2-ethylpentane’ isn’t a real structure, since drawing it will leave you with 3-methylhexane as shown in the image.
